CymitQuimica logo

CAS 1049695-95-5

:

1-(4-Methoxyphenyl)-2-benzylaminopropane hydrochloride

Description:
1-(4-Methoxyphenyl)-2-benzylaminopropane hydrochloride, identified by its CAS number 1049695-95-5, is a chemical compound that belongs to the class of substituted phenethylamines. It features a propyl chain linked to a benzylamine moiety and a methoxy-substituted phenyl group, which contributes to its unique pharmacological properties. This compound is typically characterized by its hydrochloride salt form, which enhances its solubility in water and facilitates its use in various applications, including research in pharmacology and medicinal chemistry. The presence of the methoxy group can influence its biological activity, potentially affecting receptor interactions and metabolic pathways. As with many compounds in this class, it may exhibit stimulant or psychoactive effects, although specific biological activities would depend on further empirical studies. Safety and handling precautions are essential, as with any chemical substance, due to potential toxicity and regulatory considerations.
Formula:C17H22ClNO
InChI:InChI=1S/C17H21NO.ClH/c1-14(18-13-16-6-4-3-5-7-16)12-15-8-10-17(19-2)11-9-15;/h3-11,14,18H,12-13H2,1-2H3;1H
InChI key:SUSBWRIJXPEFFJ-UHFFFAOYSA-N
SMILES:CC(CC1=CC=C(C=C1)OC)NCC2=CC=CC=C2.Cl
Found 4 products.