CymitQuimica logo

CAS 1049713-26-9

:

3-Thiophenemethanamine, N-butyl-, hydrochloride (1:1)

Description:
3-Thiophenemethanamine, N-butyl-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which contributes to its aromatic properties and potential biological activity. The presence of the butyl group enhances its lipophilicity, allowing for better membrane permeability, which is significant in pharmacological contexts. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in various applications, including pharmaceuticals. The compound may exhibit properties such as being a potential neurotransmitter or modulator due to the amine functional group, which can participate in hydrogen bonding and ionic interactions. Its specific characteristics, including melting point, solubility, and reactivity, would depend on the conditions of use and the presence of other substances. Safety data should be consulted to understand its handling and potential hazards, as with any chemical compound. Overall, 3-Thiophenemethanamine, N-butyl-, hydrochloride is of interest in both synthetic and medicinal chemistry.
Formula:C9H15NS·ClH
InChI:InChI=1S/C9H15NS.ClH/c1-2-3-5-10-7-9-4-6-11-8-9;/h4,6,8,10H,2-3,5,7H2,1H3;1H
InChI key:InChIKey=KJENFLQMPQWVRK-UHFFFAOYSA-N
SMILES:C(NCCCC)C=1C=CSC1.Cl
Synonyms:
  • 3-Thiophenemethanamine, N-butyl-, hydrochloride (1:1)
Found 1 products.