CymitQuimica logo

CAS 1049730-46-2

:

1,4-Dioxaspiro[4.5]dec-7-ene,7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-

Description:
1,4-Dioxaspiro[4.5]dec-7-ene,7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)- is a complex organic compound characterized by its unique spirocyclic structure, which incorporates both dioxole and dioxaborolane functionalities. The presence of the dioxaspiro framework contributes to its potential applications in organic synthesis and materials science, particularly in the development of novel polymers or as intermediates in chemical reactions. The compound features a boron-containing moiety, which can enhance its reactivity and solubility in various solvents, making it useful in coordination chemistry and catalysis. Additionally, the tetramethyl groups provide steric hindrance, influencing the compound's reactivity and stability. Its molecular structure suggests potential applications in medicinal chemistry, particularly in drug design, due to the ability to modify its properties through substitution. Overall, this compound exemplifies the intricate interplay between structure and function in organic chemistry, highlighting the importance of functional groups in determining chemical behavior and reactivity.
Formula:C14H23BO4
InChI:InChI=1S/C14H23BO4/c1-12(2)13(3,4)19-15(18-12)11-6-5-7-14(10-11)16-8-9-17-14/h6H,5,7-10H2,1-4H3
InChI key:XSOMCRLPERTSIS-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CCCC3(C2)OCCO3
Found 2 products.