CymitQuimica logo

CAS 1049730-81-5

:

1-Boc-3-((MethylaMino)Methyl)azetidine

Description:
1-Boc-3-((Methylamino)methyl)azetidine is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocycle containing one nitrogen atom. The "Boc" (tert-butyloxycarbonyl) group is a common protecting group used in organic synthesis, particularly in the protection of amines. This compound features a methylamino group, indicating the presence of a methyl group attached to the nitrogen atom, which can influence its reactivity and solubility. The azetidine ring contributes to the compound's rigidity and can affect its biological activity. The presence of the Boc group suggests that the compound may be used in peptide synthesis or other applications where amine protection is necessary. Overall, 1-Boc-3-((Methylamino)methyl)azetidine is of interest in medicinal chemistry and organic synthesis due to its structural features and potential applications in drug development. Its specific properties, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from relevant literature for detailed applications.
Formula:C10H20N2O2
InChI:InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-6-8(7-12)5-11-4/h8,11H,5-7H2,1-4H3
InChI key:LNDGYTKISRFVOI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CC(C1)CNC
Found 4 products.