CymitQuimica logo

CAS 1049741-04-9

:

2-[(4-chlorophenyl)methyl]-L-Proline hydrochloride

Description:
2-[(4-Chlorophenyl)methyl]-L-Proline hydrochloride is a chemical compound characterized by its proline backbone, which is an amino acid known for its role in protein synthesis. The presence of a 4-chlorobenzyl group enhances its lipophilicity and may influence its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for pharmaceutical applications. This compound may exhibit properties such as being a potential inhibitor or modulator in various biochemical pathways, making it of interest in medicinal chemistry. Its structure suggests it could interact with specific receptors or enzymes, potentially leading to therapeutic effects. The hydrochloride form also aids in stability and shelf-life, which are critical for drug formulation. Overall, 2-[(4-chlorophenyl)methyl]-L-Proline hydrochloride represents a unique compound with potential applications in drug development and research, particularly in areas related to neurochemistry and metabolic processes.
Formula:C12H15Cl2NO2
InChI:InChI=1S/C12H14ClNO2.ClH/c13-10-4-2-9(3-5-10)8-12(11(15)16)6-1-7-14-12;/h2-5,14H,1,6-8H2,(H,15,16);1H/t12-;/m1./s1
InChI key:GAZLJSPDJWUETJ-UTONKHPSSA-N
SMILES:C1C[C@@](NC1)(CC2=CC=C(C=C2)Cl)C(=O)O.Cl
Synonyms:
  • (2R)-2-[(4-chlorophenyl)methyl]pyrrolidine-2-carboxylic acid hydrochloride
  • 2-(4-Chlorobenzyl)-L-proline hydrochloride
  • (R)-Alpha-(4-chloro-benzyl)-ProHCl
  • 2-[(4-chlorophenyl)methyl]-L-Proline hydrochloride
Found 2 products.