CymitQuimica logo

CAS 10498-35-8

:

cis-1,2-Dichlorocyclohexane

Description:
Cis-1,2-Dichlorocyclohexane is a cyclic organic compound characterized by the presence of two chlorine atoms attached to adjacent carbon atoms in a cyclohexane ring, specifically in a cis configuration. This configuration results in both chlorine atoms being on the same side of the ring, which influences the compound's physical and chemical properties. It is a colorless to pale yellow liquid at room temperature, exhibiting a relatively high density compared to water. The compound is non-polar, making it less soluble in water but more soluble in organic solvents. Cis-1,2-Dichlorocyclohexane has a moderate boiling point and can undergo various chemical reactions typical of haloalkanes, such as nucleophilic substitution and elimination reactions. It is used in organic synthesis and as an intermediate in the production of other chemicals. Safety considerations include its potential toxicity and environmental impact, necessitating proper handling and disposal measures. Overall, its unique structure and reactivity make it a compound of interest in both industrial and research applications.
Formula:C6H10Cl2
InChI:InChI=1/C6H10Cl2/c7-5-3-1-2-4-6(5)8/h5-6H,1-4H2/t5-,6+
Synonyms:
  • Cyclohexane, 1,2-dichloro-, cis-
  • (1R,2S)-1,2-dichlorocyclohexane
Found 1 products.