CAS 10499-17-9

3-(4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol

Description:

3-(4-Methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol, with the CAS number 10499-17-9, is a chemical compound that belongs to the class of flavonoids, specifically a type of chromenol. This compound features a chromene backbone, which is characterized by a fused benzene and pyran ring structure. The presence of a methoxy group on the phenyl ring enhances its lipophilicity and may influence its biological activity. The hydroxyl group at the 7-position contributes to its potential antioxidant properties. This compound is of interest in various fields, including medicinal chemistry, due to its possible therapeutic effects, such as anti-inflammatory and anticancer activities. Its solubility and stability can vary depending on the solvent and environmental conditions. As with many organic compounds, it is essential to handle it with care, considering safety protocols to avoid exposure. Further studies may be required to fully elucidate its pharmacological properties and potential applications in drug development.

Formula: C₁₆H₁₆O₃

InChI: InChI=1/C16H16O3/c1-18-15-6-3-11(4-7-15)13-8-12-2-5-14(17)9-16(12)19-10-13/h2-7,9,13,17H,8,10H2,1H3

SMILES: COc1ccc(cc1)C1Cc2ccc(cc2OC1)O

3-(4-methoxyphenyl)-3,4-dihydro-2H-chromen-7-ol

CAS: 10499-17-9

Formula: C₁₆H₁₆O₃

Purity: 95%~99%

Molecular weight: 256.301

Ref: BP-BP3926

7-Hydroxy-4'-methoxyisoflavan

CAS: 10499-17-9

7-Hydroxy-4'-methoxyisoflavan is a naturally occurring isoflavan, which is a type of flavonoid compound predominantly derived from leguminous plants. Isoflavans are a subclass of isoflavonoids that are known for their diverse biological activities. This particular compound is often extracted from plants in the Fabaceae family and exhibits a rich chemical framework that supports multiple pharmacological functions.

Formula: C₁₆H₁₆O₃

Purity: Min. 95%

Molecular weight: 256.3 g/mol

Ref: 3D-FH65424