CymitQuimica logo

CAS 1049978-65-5

:

(3S,4R)-4-(3-(Trifluoromethyl)phenyl)pyrrolidine-3-carboxylic acid

Description:
The chemical substance known as (3S,4R)-4-(3-(Trifluoromethyl)phenyl)pyrrolidine-3-carboxylic acid, with the CAS number 1049978-65-5, is a chiral compound featuring a pyrrolidine ring. This compound is characterized by the presence of a trifluoromethyl group attached to a phenyl ring, which significantly influences its chemical properties and biological activity. The stereochemistry indicated by the (3S,4R) configuration suggests specific spatial arrangements of its atoms, which can affect its interactions with biological targets, making it potentially relevant in pharmaceutical applications. The carboxylic acid functional group contributes to its acidity and solubility in polar solvents, while the trifluoromethyl group enhances lipophilicity and can improve metabolic stability. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its unique structural features and stereochemistry are essential for understanding its reactivity and potential applications in various fields.
Formula:C12H12F3NO2
InChI:InChI=1S/C12H12F3NO2.ClH/c13-12(14,15)8-3-1-2-7(4-8)9-5-16-6-10(9)11(17)18;/h1-4,9-10,16H,5-6H2,(H,17,18);1H/t9-,10+;/m0./s1
InChI key:QDRXDKSFBQDVPX-BAUSSPIASA-N
SMILES:C1[C@H]([C@@H](CN1)C(=O)O)C2=CC(=CC=C2)C(F)(F)F.Cl
Found 2 products.