CymitQuimica logo

CAS 1049984-33-9

:

(3S,4R)-4-Phenylpyrrolidine-3-carboxylic acid

Description:
(3S,4R)-4-Phenylpyrrolidine-3-carboxylic acid is a chiral compound characterized by its pyrrolidine ring structure, which features a phenyl group at the 4-position and a carboxylic acid functional group at the 3-position. The specific stereochemistry, indicated by the (3S,4R) designation, suggests that the molecule has distinct spatial arrangements that can influence its biological activity and interactions. This compound is of interest in medicinal chemistry and pharmaceutical research due to its potential applications in drug development, particularly in the context of neuroactive compounds. The presence of the carboxylic acid group contributes to its acidity and solubility in polar solvents, while the phenyl group may enhance lipophilicity, affecting its pharmacokinetic properties. Additionally, the stereochemistry plays a crucial role in determining the compound's interaction with biological targets, making it essential for studies related to its efficacy and safety in therapeutic applications. Overall, (3S,4R)-4-Phenylpyrrolidine-3-carboxylic acid exemplifies the importance of molecular structure in the development of bioactive compounds.
Formula:C11H13NO2
InChI:InChI=1S/C11H13NO2/c13-11(14)10-7-12-6-9(10)8-4-2-1-3-5-8/h1-5,9-10,12H,6-7H2,(H,13,14)/t9-,10+/m0/s1
InChI key:XTJDGOQYFKHEJR-VHSXEESVSA-N
SMILES:C1[C@H]([C@@H](CN1)C(=O)O)C2=CC=CC=C2
Synonyms:
  • (3S,4R)-4-PHENYLPYRROLIDINE-3-CARBOXYLIC ACID
  • (3S,4R)-4-Phenyl-3-pyrrolidinecarboxylic acid
  • DL-trans-4-Phenylpyrrolidine-3-carboxylic acid
  • 3-Pyrrolidinecarboxylicacid, 4-phenyl-, (3S,4R)-
Found 1 products.