CymitQuimica logo

CAS 105009-71-0

:

Bis(2-(2-hydroxyethoxy)ethyl) (4-methyl-1,3-phenylene)dicarbamate

Description:
Bis(2-(2-hydroxyethoxy)ethyl)(4-methyl-1,3-phenylene)dicarbamate, identified by CAS number 105009-71-0, is an organic compound characterized by its dual carbamate functional groups and a phenylene moiety. This substance features a central aromatic ring substituted with a methyl group, enhancing its hydrophobic characteristics while also providing structural stability. The presence of two hydroxyethoxy ethyl groups contributes to its solubility in polar solvents and may enhance its compatibility with various formulations. The dicarbamate structure suggests potential applications in polymer chemistry, particularly in the synthesis of polyurethanes or as a crosslinking agent due to its ability to form strong covalent bonds. Additionally, the compound may exhibit interesting biological properties, making it a candidate for further research in medicinal chemistry or materials science. Its stability, reactivity, and solubility characteristics make it a versatile compound in both industrial and research applications. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C17H26N2O8
InChI:InChI=1S/C17H26N2O8/c1-13-2-3-14(18-16(22)26-10-8-24-6-4-20)12-15(13)19-17(23)27-11-9-25-7-5-21/h2-3,12,20-21H,4-11H2,1H3,(H,18,22)(H,19,23)
InChI key:OLYQPHLZVHXEHK-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=C1)NC(=O)OCCOCCO)NC(=O)OCCOCCO
Synonyms:
  • Bis(2-(2-hydroxyethoxy)ethyl) (4-methyl-1,3-phenylene)dicarbamate
Found 3 products.