CymitQuimica logo

CAS 1050510-12-7

:

B-[4-[(2-Thienylmethoxy)methyl]phenyl]boronic acid

Description:
B-[4-[(2-Thienylmethoxy)methyl]phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a phenyl ring substituted with a thienylmethoxy group, which enhances its solubility and reactivity. The thienyl moiety contributes to the compound's electronic properties, potentially influencing its interactions in biological systems. Boronic acids are often utilized in the development of sensors, drug delivery systems, and as intermediates in the synthesis of complex organic molecules. Additionally, the presence of the boron atom allows for participation in cross-coupling reactions, a key strategy in the formation of carbon-carbon bonds. Overall, this compound exemplifies the versatility of boronic acids in both synthetic and applied chemistry contexts.
Formula:C12H13BO3S
InChI:InChI=1S/C12H13BO3S/c14-13(15)11-5-3-10(4-6-11)8-16-9-12-2-1-7-17-12/h1-7,14-15H,8-9H2
InChI key:InChIKey=VNHRAFWDOVYDFC-UHFFFAOYSA-N
SMILES:B(O)(O)C1=CC=C(COCC2=CC=CS2)C=C1
Synonyms:
  • [4-[(Thiophen-2-ylmethoxy)methyl]phenyl]boronic acid
  • B-[4-[(2-Thienylmethoxy)methyl]phenyl]boronic acid
  • Boronic acid, B-[4-[(2-thienylmethoxy)methyl]phenyl]-
Found 1 products.