CAS 105104-40-3
:Chloromethyldioxahexene; 96%
Description:
Chloromethyldioxahexene, with the CAS number 105104-40-3, is a chemical compound characterized by its unique structure that includes both chloromethyl and dioxane functionalities. This substance typically appears as a colorless to pale yellow liquid and is known for its reactivity due to the presence of the chloromethyl group, which can participate in various chemical reactions, including nucleophilic substitutions. The dioxane moiety contributes to its solubility in organic solvents and may influence its physical properties, such as boiling point and density. Chloromethyldioxahexene is often utilized in organic synthesis, particularly in the preparation of more complex molecules, and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Due to its chemical nature, it is essential to handle this compound with care, observing appropriate safety protocols to mitigate risks associated with its reactivity and potential toxicity. As with any chemical, proper storage and disposal methods should be followed to ensure safety and environmental protection.
Formula:C5H9ClO2
InChI:InChI=1/C5H9ClO2/c1-5(3-6)8-4-7-2/h1,3-4H2,2H3
SMILES:C=C(CCl)OCOC
Synonyms:- 2-(Chloromethyl)-3,5-dioxahex-1-ene
- 3-Chloro-2-(Methoxymethoxy)Prop-1-Ene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-(Chloromethyl)-3,5-dioxahex-1-ene
CAS:Formula:C5H9ClO2Purity:>96.0%(GC)Color and Shape:Colorless to Light yellow clear liquidMolecular weight:136.582-(Chloromethyl)-3,5-dioxahex-1-ene
CAS:2-(Chloromethyl)-3,5-dioxahex-1-eneFormula:C5H9ClO2Purity:97%Color and Shape:Clear Liquid-ClearMolecular weight:136.576762-(Chloromethyl)-3,5-dioxahex-1-ene
CAS:Formula:C5H9ClO2Purity:96%Color and Shape:LiquidMolecular weight:136.57682-(Chloromethyl)-3,5-dioxahex-1-ene
CAS:Formula:C5H9ClO2Purity:≥96%Color and Shape:LiquidMolecular weight:136.582-(Chloromethyl)-3,5-dioxahex-1-ene
CAS:2-(Chloromethyl)-3,5-dioxahex-1-ene is a synthetic compound that belongs to the group of piperidine compounds. It is a nucleophile and a primary amine that reacts with carbonyl compounds in an efficient method. This reaction is stereoselective and produces the corresponding 2-(chloromethyl)-3,5-dioxahex-1-enes. The chloride ion can be replaced by other nucleophiles such as methoxymethyl or amines. The malonate ester can also be used for this reaction.
2-(Chloromethyl)-3,5-dioxahex-1-ene has been shown to react with phenylacetonitrile and chloride ions to produce alkylated products such as 2-(chloromethyl)-3,5-dioxahexanenitrile or 2-(chloromethyl)-4,6-dioxFormula:C5H9ClO2Purity:Min. 95%Molecular weight:136.58 g/mol





