CAS 1051487-82-1

Formula: C19H18BrN3O2

InChI: InChI=1S/C19H18BrN3O2/c1-12(14-8-5-9-15(20)10-14)22-23-19(25)17-16(11-21-18(17)24)13-6-3-2-4-7-13/h2-10,16-17H,11H2,1H3,(H,21,24)(H,23,25)/b22-12+/t16-,17-/m1/s1

InChI key: RQKXQCSEZPQBNZ-CBCLUANDSA-N

SMILES: C/C(=N\NC(=O)[C@@H]1[C@H](CNC1=O)C2=CC=CC=C2)/C3=CC(=CC=C3)Br

AC-264613

CAS: 1051487-82-1

AC-264613

Formula: C₁₉H₁₈BrN₃O₂

Purity: ≥95%

Molecular weight: 400.27

Ref: 54-OR1136826

AC-264613

CAS: 1051487-82-1

Purity: 95%

Ref: IN-DA008Y4L

AC-264613

CAS: 1051487-82-1

AC-264613 is an agonist of the GPCR protease-activated receptor 2 (PAR2). AC-264613 suppresses interferon regulatory factor 5.

Formula: C₁₉H₁₈BrN₃O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 400.28

Ref: TM-T4186

AC 264613

CAS: 1051487-82-1

AC 264613 is a serine protease inhibitor that inhibits the activity of cathepsin B, which is an enzyme that degrades extracellular matrix proteins and plays a role in inflammation. AC 264613 has been shown to be effective against influenza virus, HIV-1, and herpes simplex virus type 1. This drug also blocks the activation of colony-stimulating factor by inhibiting the production of neutrophils. It has been shown to inhibit the activation of toll-like receptor 4 (TLR4) by preventing hyperpolarization of cells membranes. AC 264613 is a stereoselective compound that can be used for assays as it binds to polyvinylpyrrolidone (PVP).

Formula: C₁₉H₁₈BrN₃O₂

Purity: Min. 95%

Molecular weight: 400.27 g/mol

Ref: 3D-BSB48782