CymitQuimica logo

CAS 1051919-38-0

:

Piperidine, 4-(3,4-difluorophenoxy)-, hydrochloride (1:1)

Description:
Piperidine, 4-(3,4-difluorophenoxy)-, hydrochloride (1:1) is a chemical compound characterized by its piperidine core, which is a six-membered saturated heterocyclic ring containing one nitrogen atom. The compound features a 3,4-difluorophenoxy group, indicating the presence of a phenolic structure substituted with two fluorine atoms at the 3 and 4 positions. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical contexts. The presence of the difluorophenoxy moiety may impart specific biological activities, making it of interest in medicinal chemistry. The compound's molecular structure suggests potential interactions with biological targets, and its hydrochloride form may influence its pharmacokinetic properties. Safety and handling precautions should be observed, as with all chemical substances, particularly those with potential biological activity. Further studies would be necessary to elucidate its specific properties, including stability, reactivity, and potential applications in drug development.
Formula:C11H13F2NO·ClH
InChI:InChI=1S/C11H13F2NO.ClH/c12-10-2-1-9(7-11(10)13)15-8-3-5-14-6-4-8;/h1-2,7-8,14H,3-6H2;1H
InChI key:InChIKey=IHYVWAGJHCWHIJ-UHFFFAOYSA-N
SMILES:O(C1=CC(F)=C(F)C=C1)C2CCNCC2.Cl
Synonyms:
  • 4-(3,4-Difluorophenyloxy)piperidine hydrochloride
  • Piperidine, 4-(3,4-difluorophenoxy)-, hydrochloride (1:1)
Found 5 products.