CAS 105229-14-9
:1,3-Benzodioxole-5-propanoicacid, a-amino-b-hydroxy-, (aR,bS)-
Description:
1,3-Benzodioxole-5-propanoic acid, α-amino-β-hydroxy-, (αR,βS)-, is a chemical compound characterized by its unique structural features, which include a benzodioxole ring system and a propanoic acid moiety. This compound exhibits both acidic and basic properties due to the presence of the carboxylic acid group and the amino group, making it a zwitterionic species in certain pH conditions. The stereochemistry indicated by (αR,βS) suggests specific spatial arrangements of the substituents around the chiral centers, which can influence its biological activity and interactions. It is often studied in the context of pharmaceuticals and biochemistry due to its potential roles in various biological pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, its unique structure and functional groups contribute to its significance in medicinal chemistry and potential therapeutic applications.
Formula:C10H11NO5
InChI:InChI=1S/C10H11NO5/c11-8(10(13)14)9(12)5-1-2-6-7(3-5)16-4-15-6/h1-3,8-9,12H,4,11H2,(H,13,14)/t8-,9+/m1/s1
InChI key:QNECLCOECOXTEW-BDAKNGLRSA-N
SMILES:C1OC2=C(O1)C=C(C=C2)[C@@H]([C@H](C(=O)O)N)O
Synonyms:- 1,3-Benzodioxole-5-propanoicacid, a-amino-b-hydroxy-, [S-(R*,S*)]-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
(2R,3S)-2-Amino-3-(benzo[d][1,3]dioxol-5-yl)-3-hydroxypropanoic acid
CAS:Formula:C10H11NO5Molecular weight:225.1980

