CymitQuimica logo

CAS 10524-65-9

:

1H-Pyrrole, 1,3-dimethyl-

Description:
1H-Pyrrole, 1,3-dimethyl- is an organic compound characterized by a five-membered aromatic ring containing one nitrogen atom. It is a derivative of pyrrole, with two methyl groups attached to the first and third carbon atoms of the ring. This compound is typically a colorless to pale yellow liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate polarity. The presence of the nitrogen atom contributes to its basicity and reactivity, making it a useful intermediate in the synthesis of various pharmaceuticals, agrochemicals, and dyes. Additionally, 1H-Pyrrole, 1,3-dimethyl- can participate in electrophilic aromatic substitution reactions due to the electron-donating nature of the methyl groups, enhancing its reactivity. Safety data indicates that it should be handled with care, as it may pose health risks upon exposure. Overall, this compound is significant in organic chemistry and materials science for its versatile chemical properties and applications.
Formula:C6H9N
InChI:InChI=1S/C6H9N/c1-6-3-4-7(2)5-6/h3-5H,1-2H3
InChI key:CTWQGTOWGFCWNW-UHFFFAOYSA-N
SMILES:CC1=CN(C=C1)C
Found 3 products.