CAS 1052532-15-6
:N-[[4-[(6-Chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-3,4-dimethoxybenzeneethanamine hydrochloride
Description:
N-[[4-[(6-Chloro-3-pyridinyl)methoxy]-3-methoxyphenyl]methyl]-3,4-dimethoxybenzeneethanamine hydrochloride, with CAS number 1052532-15-6, is a chemical compound characterized by its complex structure, which includes multiple methoxy groups and a pyridine ring. This compound is typically classified as a pharmaceutical agent, often investigated for its potential therapeutic effects. Its molecular structure suggests it may interact with various biological targets, potentially influencing neurotransmitter systems. The presence of the chloro and methoxy substituents can affect its solubility, stability, and biological activity. As a hydrochloride salt, it is likely to be more soluble in water, facilitating its use in formulations. The compound's synthesis and characterization would involve standard organic chemistry techniques, and its properties can be assessed through various analytical methods such as NMR, mass spectrometry, and chromatography. Safety and handling precautions are essential, as with any chemical substance, particularly in a laboratory or pharmaceutical context.
Formula:C24H27ClN2O4·HCl
InChI:InChI=1S/C24H27ClN2O4.ClH/c1-28-20-7-4-17(12-22(20)29-2)10-11-26-14-18-5-8-21(23(13-18)30-3)31-16-19-6-9-24(25)27-15-19;/h4-9,12-13,15,26H,10-11,14,16H2,1-3H3;1H
InChI key:QBGSVDJLQQXEGG-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C=C1)CCNCC2=CC(=C(C=C2)OCC3=CN=C(C=C3)Cl)OC)OC.Cl
Synonyms:- SBE 13 hydrochloride
- N-(4-((6-Chloropyridin-3-yl)methoxy)-3-methoxybenzyl)-2-(3,4-dimethoxyphenyl)ethanamine hydrochloride
- SBE-13 HCl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
SBE13 Hydrochloride
CAS:Formula:C24H28Cl2N2O4Purity:98%Color and Shape:SolidMolecular weight:479.3961SBE13 Hydrochloride
CAS:SBE13 Hydrochloride (SBE 13 HCl) is an effective and specific PLK1 inhibitor (IC50: 0.2 nM); no inhibition om Aurora A kinase, Plk2/3.Formula:C24H28Cl2N2O4Purity:99.00% - ≥95%Color and Shape:SolidMolecular weight:479.4SBE13 Hydrochloride
CAS:Controlled ProductSBE13 is a small molecule that inhibits the transcription-polymerase chain reaction in myeloid leukemia cells. It has been shown to induce autophagy, a process by which cells degrade their own components and recycle nutrients in response to stress, such as DNA damage or nutrient deprivation. SBE13 also inhibits lipid kinases, resulting in decreased cell proliferation and reduced levels of phosphorylated proteins. This drug has been shown to be effective against HIV infection and ischemic brain damage.Formula:C24H27ClN2O4•HClPurity:Min. 95%Molecular weight:442.94 g/mol



