CAS 105256-12-0
:4-[(2S,3R,4R)-4-(4-hydroxy-3-methoxybenzyl)-3-(hydroxymethyl)tetrahydrofuran-2-yl]-2,6-dimethoxyphenol
Description:
The chemical substance known as "4-[(2S,3R,4R)-4-(4-hydroxy-3-methoxybenzyl)-3-(hydroxymethyl)tetrahydrofuran-2-yl]-2,6-dimethoxyphenol" with the CAS number 105256-12-0 is a complex organic compound characterized by its multi-functional structure. It features a tetrahydrofuran ring, which contributes to its cyclic nature, and multiple methoxy and hydroxyl groups that enhance its solubility and reactivity. The presence of a dimethoxyphenol moiety suggests potential antioxidant properties, while the specific stereochemistry indicated by the (2S,3R,4R) configuration implies that it may exhibit chiral characteristics, influencing its biological activity and interactions. This compound may be of interest in medicinal chemistry due to its potential therapeutic applications, particularly in the fields of anti-inflammatory or antioxidant research. Its structural complexity and functional groups suggest that it could participate in various chemical reactions, making it a candidate for further study in drug development or as a biochemical probe.
Formula:C21H26O7
InChI:InChI=1/C21H26O7/c1-25-17-7-12(4-5-16(17)23)6-14-11-28-21(15(14)10-22)13-8-18(26-2)20(24)19(9-13)27-3/h4-5,7-9,14-15,21-24H,6,10-11H2,1-3H3/t14-,15-,21+/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5'-Methoxylariciresinol
CAS:5'-Methoxylariciresinol is a natural product from Stellera chamaejasme.Formula:C21H26O7Purity:98%Color and Shape:SolidMolecular weight:390.435'-Methoxylariciresinol
CAS:<p>5'-Methoxylariciresinol is a naturally occurring lignan, which is a polyphenolic compound derived from plant sources such as flaxseeds, sesame seeds, and various other dietary plants. This compound is part of the broader class of lignans known for their presence in fiber-rich plants. Its mode of action primarily involves its role as an antioxidant, where it neutralizes free radicals and reduces oxidative stress, potentially influencing various biological pathways related to inflammation and cellular aging.</p>Formula:C21H26O7Purity:Min. 95%Molecular weight:390.4 g/mol3-Furanmethanol,tetrahydro-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-[(4-hydroxy-3-methoxyphenyl)methyl]-,(2R,3S,4S)-rel-
CAS:Formula:C21H26O7Purity:98.0%Molecular weight:390.4269



