CymitQuimica logo

CAS 1052713-46-8

:

trans-3-(boc-amino)-4-fluoropiperidine

Description:
Trans-3-(Boc-amino)-4-fluoropiperidine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The "trans" designation indicates the specific stereochemistry of the substituents on the piperidine ring, which can significantly influence its biological activity and reactivity. The presence of a Boc (tert-butyloxycarbonyl) protecting group on the amino group suggests that this compound is often used in peptide synthesis or as an intermediate in organic synthesis, as the Boc group can be easily removed under acidic conditions. The fluorine atom at the 4-position enhances the compound's lipophilicity and may affect its pharmacological properties. This compound is of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential interactions with biological targets. Its unique structural features make it a valuable building block in the synthesis of more complex molecules. As with any chemical substance, proper handling and safety precautions should be observed, especially when dealing with reactive or potentially hazardous materials.
Formula:C10H19FN2O2
InChI:InChI=1S/C10H19FN2O2/c1-10(2,3)15-9(14)13-8-6-12-5-4-7(8)11/h7-8,12H,4-6H2,1-3H3,(H,13,14)/t7-,8-/m1/s1
InChI key:PHKRFWRGEVHCAT-HTQZYQBOSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H]1CNCC[C@H]1F
Found 5 products.