CymitQuimica logo

CAS 105283-60-1

:

Pyridine, 4-(4-piperidinylthio)-, dihydrochloride

Description:
Pyridine, 4-(4-piperidinylthio)-, dihydrochloride, with the CAS number 105283-60-1, is a chemical compound characterized by its pyridine ring structure substituted with a piperidinylthio group. This compound typically appears as a white to off-white solid and is soluble in water due to the presence of the dihydrochloride form, which enhances its ionic character. The presence of the piperidine moiety contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. Pyridine derivatives are known for their role as bases and nucleophiles in organic reactions, and this particular compound may exhibit properties such as antimicrobial or anti-inflammatory activities. Its synthesis often involves the reaction of pyridine derivatives with piperidine and a suitable thiol, followed by hydrochloric acid treatment to form the dihydrochloride salt. As with many chemical substances, handling should be done with care, considering potential toxicity and the need for appropriate safety measures in laboratory settings.
Formula:C10H14N2S・2ClH
InChI:InChI=1S/C10H14N2S.2ClH/c1-5-11-6-2-9(1)13-10-3-7-12-8-4-10;;/h1-2,5-6,10,12H,3-4,7-8H2;2*1H
InChI key:XWAPNPQBYRPTQI-UHFFFAOYSA-N
SMILES:C1CNCCC1SC2=CC=NC=C2.Cl.Cl
Found 2 products.