CymitQuimica logo

CAS 105300-90-1

:

4-(BOC-4-AMINOPHENYL)-BUTANOIC ACID

Description:
4-(BOC-4-Aminophenyl)-butanoic acid, with the CAS number 105300-90-1, is a chemical compound characterized by its structure, which includes a butanoic acid moiety and a tert-butyloxycarbonyl (BOC) protecting group attached to an aminophenyl group. This compound is typically used in organic synthesis, particularly in the development of pharmaceuticals and biologically active molecules. The BOC group serves as a protective group for the amine, allowing for selective reactions without affecting the amine functionality. The presence of the butanoic acid component contributes to its potential as a building block in peptide synthesis or as an intermediate in the preparation of more complex organic compounds. The compound is likely to exhibit moderate solubility in organic solvents and may have specific reactivity patterns due to the functional groups present. As with many organic compounds, handling should be done with care, following appropriate safety protocols to mitigate any risks associated with its use.
Formula:C15H21NO4
InChI:InChI=1S/C15H21NO4/c1-15(2,3)20-14(19)16-12-9-7-11(8-10-12)5-4-6-13(17)18/h7-10H,4-6H2,1-3H3,(H,16,19)(H,17,18)
InChI key:JVKQXXXBFHIZTQ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)NC1=CC=C(C=C1)CCCC(=O)O
Found 4 products.