CymitQuimica logo

CAS 105310-07-4

:

Cyclopropanecarboxamide, 2-(aminomethyl)-N-ethyl-1-phenyl-, cis-

Description:
Cyclopropanecarboxamide, 2-(aminomethyl)-N-ethyl-1-phenyl-, cis- is a chemical compound characterized by its unique structure, which includes a cyclopropane ring and an amide functional group. The presence of the aminomethyl group indicates that there is an amino group (-NH2) attached to a methylene (-CH2-) group, contributing to its reactivity and potential biological activity. The N-ethyl and phenyl substituents enhance its lipophilicity and may influence its interaction with biological targets. This compound is likely to exhibit properties typical of amides, such as moderate polarity and the ability to participate in hydrogen bonding. Its cis configuration suggests specific stereochemical arrangements that can affect its physical and chemical properties, including solubility and melting point. Cyclopropanecarboxamide derivatives are of interest in medicinal chemistry due to their potential pharmacological applications, including roles as intermediates in drug synthesis or as active pharmaceutical ingredients. However, detailed studies on its specific biological activity and safety profile would be necessary for comprehensive understanding.
Formula:C13H18N2O
InChI:InChI=1S/C13H18N2O/c1-2-15-12(16)13(8-11(13)9-14)10-6-4-3-5-7-10/h3-7,11H,2,8-9,14H2,1H3,(H,15,16)/t11-,13+/m1/s1
InChI key:UVKUMJGXPDEXSQ-YPMHNXCESA-N
SMILES:CCNC(=O)[C@@]1(C[C@@H]1CN)C2=CC=CC=C2
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.