CymitQuimica logo

CAS 105310-73-4

:

Cyclopropanecarboxamide,2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]-N-ethyl-1-phenyl-,cis-

Description:
Cyclopropanecarboxamide, 2-[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)methyl]-N-ethyl-1-phenyl-, cis- (CAS 105310-73-4) is a chemical compound characterized by its unique structural features, including a cyclopropanecarboxamide moiety and an isoindole derivative. The presence of the cyclopropane ring contributes to its rigidity and may influence its reactivity and interaction with biological targets. The compound exhibits amide functionality, which is known for its ability to form hydrogen bonds, potentially enhancing solubility and stability in various environments. The isoindole structure introduces additional aromatic characteristics, which can affect the compound's electronic properties and reactivity. This compound may be of interest in medicinal chemistry due to its potential biological activity, although specific pharmacological data would be necessary to elucidate its therapeutic applications. Overall, the combination of these structural elements suggests that this compound could exhibit unique chemical behavior and biological interactions, warranting further investigation.
Formula:C21H20N2O3
InChI:InChI=1S/C21H20N2O3/c1-2-22-20(26)21(14-8-4-3-5-9-14)12-15(21)13-23-18(24)16-10-6-7-11-17(16)19(23)25/h3-11,15H,2,12-13H2,1H3,(H,22,26)/t15-,21+/m0/s1
InChI key:KXPNXMHTVGJNIW-YCRPNKLZSA-N
SMILES:CCNC(=O)[C@]1(C[C@H]1CN2C(=O)C3=CC=CC=C3C2=O)C4=CC=CC=C4
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.