CymitQuimica logo

CAS 105321-49-1

:

1-(3'-FLUORO-4'-METHOXYPHENYL)ETHYLAMINE

Description:
1-(3'-Fluoro-4'-methoxyphenyl)ethylamine, with the CAS number 105321-49-1, is an organic compound characterized by its amine functional group and a substituted aromatic ring. The presence of a fluorine atom and a methoxy group on the phenyl ring contributes to its unique chemical properties, including potential variations in polarity and reactivity. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It may exhibit moderate solubility in organic solvents, while its solubility in water can be limited due to the hydrophobic nature of the aromatic ring. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as the modifications on the phenyl ring can influence biological activity. Additionally, the presence of the ethylamine moiety may enhance its interaction with biological targets. As with many amines, it may also exhibit basic properties, allowing it to participate in various chemical reactions, including alkylation and acylation. Safety and handling precautions should be observed due to its potential reactivity and biological effects.
Formula:C9H12FNO
InChI:InChI=1/C9H12FNO/c1-6(11)7-3-4-9(12-2)8(10)5-7/h3-6H,11H2,1-2H3
InChI key:WGUPBBABCUKYCC-UHFFFAOYSA-N
SMILES:CC(c1ccc(c(c1)F)OC)N
Synonyms:
  • 1-(3-Fluoro-4-Methoxyphenyl)Ethanamine
  • 1-(3-Fluoro-4-Methoxy-Phenyl)-Ethylamine
Found 4 products.