CAS 1053239-39-6
:2-(1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethanamine hydrochloride (1:1)
Description:
2-(1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethanamine hydrochloride is a chemical compound characterized by its unique bicyclic structure, which incorporates a tetrahydroindeno-furan moiety. This compound features an ethanamine functional group, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. The presence of the tetrahydroindeno structure suggests potential interactions with biological targets, making it of interest in medicinal chemistry. Its molecular weight, solubility, and stability can vary based on environmental conditions and formulation. The compound may exhibit properties such as being a potential ligand for receptors or enzymes, and its pharmacological profile would depend on its specific interactions within biological systems. Safety and handling precautions should be observed, as with any chemical substance, particularly in research and development contexts. Further studies would be necessary to elucidate its full range of characteristics and potential applications.
Formula:C13H18ClNO
InChI:InChI=1S/C13H17NO.ClH/c14-7-5-10-2-1-9-3-4-12-11(13(9)10)6-8-15-12;/h3-4,10H,1-2,5-8,14H2;1H
InChI key:PTRBVFJPGFTDDU-UHFFFAOYSA-N
SMILES:C1CC2=C(C1CCN)C3=C(C=C2)OCC3.Cl
Synonyms:- 2-(1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethylaMine hydrochloride
- 1,6,7,8-Tetrahydro-2H-Indeno[5,4-B]Furan-8-Ethanamine Hydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
2-(2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-yl)ethanamine hydrochloride
CAS:2-(2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-yl)ethanamine hydrochlorideFormula:C13H18ClNOPurity:98%Molecular weight:239.742-(1,6,7,8-Tetrahydro-2H-indeno[5,4-b]furan-8-yl)ethylamine hydrochloride
CAS:Formula:C13H18ClNOPurity:98%Color and Shape:SolidMolecular weight:239.7411Ref: IN-DA008TBY
100mg40.00€250mg51.00€1g85.00€5g225.00€10g238.00€25g631.00€100g1,238.00€500g3,874.00€Ramelteon Impurity 7 HCl
CAS:Formula:C13H17NO·HClColor and Shape:White To Off-White SolidMolecular weight:203.29 36.462-(2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-yl)ethanamine hydrochloride
CAS:Purity:95.0%Molecular weight:239.740005493164062-(2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-yl)ethanamine hydrochloride
CAS:2-(2,6,7,8-Tetrahydro-1H-indeno[5,4-b]furan-8-yl)ethanamine hydrochlorideFormula:C13H18ClNOPurity:95+%Molecular weight:239.742H-Indeno[5,4-b]furan-8-ethanamine, 1,6,7,8-tetrahydro- (hydrochloride)(1:1)
CAS:2H-Indeno[5,4-b]furan-8-ethanamine, 1,6,7,8-tetrahydro-(hydrochloride)(1:1) is a monosubstituted compound that has been synthesized by the Friedel-Crafts reaction. The optical purity of the product was determined to be 98% optically pure with a specific rotation of +30.2 degrees at 20 degrees Celsius. The melting point was found to be 172 degrees Celsius and the boiling point was found to be 296 degrees Celsius. The product can also be synthesized using oxalyl chloride and raney nickel as catalysts in a transfer process. This synthesis can be carried out in two steps: In the first step, 2H-indeno[5,4-b]furan-8-ethanamine is reacted with triazolam (a benzodiazepine) in an oriented synthesis.Formula:C13H18ClNOPurity:Min. 95%Molecular weight:239.74 g/mol






