CymitQuimica logo

CAS 105362-45-6

:

(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methylamine

Description:
(5-Methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methylamine, with the CAS number 105362-45-6, is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a methyl group and a phenyl group attached to the triazole ring, contributing to its unique chemical properties and potential biological activity. The presence of the amino group (-NH2) indicates that it can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding, which may enhance its solubility and reactivity. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the triazole moiety's known role in drug design. Additionally, its characteristics may include moderate polarity, which can influence its interaction with biological systems. Overall, this compound's unique structural features make it a subject of interest for further research in various chemical and biological applications.
Formula:C10H12N4
InChI:InChI=1/C10H12N4/c1-8-10(7-11)13-14(12-8)9-5-3-2-4-6-9/h2-6H,7,11H2,1H3
InChI key:NUKMUNLDDAJKOE-UHFFFAOYSA-N
SMILES:Cc1c(CN)nn(c2ccccc2)n1
Synonyms:
  • 1-(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methanamine
Found 1 products.