CymitQuimica logo

CAS 1053656-43-1

:

1,1-Dimethylethyl N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]carbamate

Description:
1,1-Dimethylethyl N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]carbamate, identified by its CAS number 1053656-43-1, is a chemical compound that features a carbamate functional group, which is characterized by the presence of a carbonyl group (C=O) bonded to a nitrogen atom (N) that is also connected to an alkyl or aryl group. This compound includes a dimethyl substituent, indicating the presence of two methyl groups attached to a tertiary carbon, contributing to its steric bulk. The oxadiazole moiety, specifically the 5-methyl-1,3,4-oxadiazole, suggests potential biological activity, as oxadiazoles are often associated with various pharmacological properties. The compound's structure implies it may exhibit specific interactions with biological targets, making it of interest in medicinal chemistry. Additionally, its stability and solubility characteristics would depend on the overall molecular structure and substituents, influencing its potential applications in agrochemicals or pharmaceuticals. Further studies would be necessary to elucidate its precise properties and potential uses.
Formula:C9H15N3O3
InChI:InChI=1S/C9H15N3O3/c1-6-11-12-7(14-6)5-10-8(13)15-9(2,3)4/h5H2,1-4H3,(H,10,13)
InChI key:InChIKey=YWHPJNAIBYICPH-UHFFFAOYSA-N
SMILES:C(NC(OC(C)(C)C)=O)C=1OC(C)=NN1
Synonyms:
  • 2-tert-Butyloxycarbonylaminomethyl-5-methyl-[1,3,4]oxadiazole
  • Carbamic acid, N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]-, 1,1-dimethylethyl ester
  • tert-Butyl [(5-methyl-1,3,4-oxadiazol-2-yl)methyl]carbamate
  • 1,1-Dimethylethyl N-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]carbamate
Found 2 products.