CymitQuimica logo

CAS 1053656-79-3

:

Poly(oxy-1,2-ethanediyl), α-(2-carboxyethyl)-ω-(2-carboxyethoxy)-

Description:
Poly(oxy-1,2-ethanediyl), α-(2-carboxyethyl)-ω-(2-carboxyethoxy)-, commonly referred to as a type of polyether, is a polymer characterized by its hydrophilic properties due to the presence of multiple carboxylic acid groups. This structure enhances its solubility in water and makes it suitable for various applications, including as a surfactant or dispersant in formulations. The polymer features a backbone of ethylene oxide units, which contribute to its flexibility and compatibility with other substances. The terminal carboxyethyl groups provide reactive sites for further chemical modifications, allowing for the development of tailored materials with specific functionalities. Its properties can be influenced by factors such as molecular weight and the degree of polymerization, which can affect its viscosity and surface activity. Overall, this compound is significant in fields such as pharmaceuticals, cosmetics, and materials science, where its unique characteristics can be leveraged for enhanced performance in diverse applications.
Formula:(C2H4O)nC6H10O5
InChI:InChI=1S/C30H58O17/c31-29(32)1-3-35-5-7-37-9-11-39-13-15-41-17-19-43-21-23-45-25-27-47-28-26-46-24-22-44-20-18-42-16-14-40-12-10-38-8-6-36-4-2-30(33)34/h1-28H2,(H,31,32)(H,33,34)
InChI key:KOVYBDAGTRVAAO-UHFFFAOYSA-N
SMILES:C(COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O
Synonyms:
  • Poly(oxy-1,2-ethanediyl), α-(2-carboxyethyl)-ω-(2-carboxyethoxy)-
  • Polyethylene glycol bis(2-carboxyethyl) ether
Found 2 products.