CymitQuimica logo

CAS 1053657-49-0

:

2-[[6-Chloro-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid hydrazide

Description:
2-[[6-Chloro-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid hydrazide is a chemical compound characterized by its unique structural features, which include a pyridine ring substituted with a chlorine atom and a trifluoromethyl group, as well as a thioacetic acid moiety linked to a hydrazide functional group. This compound exhibits properties typical of both thioacetic acids and hydrazides, potentially displaying biological activity due to its heterocyclic structure. The presence of the trifluoromethyl group may enhance lipophilicity and influence the compound's reactivity and interaction with biological targets. Additionally, the chlorine substituent can affect the electronic properties of the molecule, potentially impacting its pharmacological profile. As with many compounds containing heteroatoms and functional groups, it may exhibit solubility in polar solvents and could participate in various chemical reactions, including nucleophilic substitutions and hydrazone formation. Overall, this compound's characteristics suggest potential applications in medicinal chemistry and drug development, although specific biological activities would require further investigation.
Formula:C8H7ClF3N3OS
InChI:InChI=1S/C8H7ClF3N3OS/c9-5-1-4(8(10,11)12)2-7(14-5)17-3-6(16)15-13/h1-2H,3,13H2,(H,15,16)
InChI key:InChIKey=QPYWOQVVWDUYEG-UHFFFAOYSA-N
SMILES:S(CC(NN)=O)C1=CC(C(F)(F)F)=CC(Cl)=N1
Synonyms:
  • 2-[[6-Chloro-4-(trifluoromethyl)-2-pyridinyl]thio]acetic acid hydrazide
  • Acetic acid, 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]thio]-, hydrazide
Found 1 products.