CAS 105377-77-3

Formula: C20H20O6

InChI: InChI=1S/C20H20O6/c1-10(2)3-8-13-14(22)9-15-16(17(13)23)18(24)19(25)20(26-15)11-4-6-12(21)7-5-11/h3-7,9,19-23,25H,8H2,1-2H3/t19-,20+/m0/s1

InChI key: DLXOCNCDPKONDY-VQTJNVASSA-N

SMILES: CC(=CCC1=C(C2=C(C=C1O)O[C@@H]([C@H](C2=O)O)C3=CC=C(C=C3)O)O)C

Shuterin

CAS: 105377-77-3

Shuterin is an advanced phytochemical compound, which is derived from specific botanical sources exhibiting anti-inflammatory and antioxidant properties. Originating from an extensive extraction and purification process, Shuterin is formulated to target cellular pathways associated with oxidative stress and inflammatory responses. Its mode of action involves the modulation of signaling pathways, such as the inhibition of pro-inflammatory cytokine production and the enhancement of superoxide dismutase activity, resulting in reduced oxidative stress and inflammation.

Formula: C₂₀H₂₀O₆

Purity: Min. 95%

Molecular weight: 356.4 g/mol

Ref: 3D-FEA37777