CymitQuimica logo

CAS 10539-14-7

:

2-amino-4,6-dibromophenol

Description:
2-Amino-4,6-dibromophenol is an organic compound characterized by the presence of an amino group and two bromine substituents on a phenolic ring. Its molecular formula is C6H4Br2N-O, indicating that it contains six carbon atoms, four hydrogen atoms, two bromine atoms, one nitrogen atom, and one oxygen atom. This compound typically appears as a solid and is known for its potential applications in the synthesis of dyes, pharmaceuticals, and other organic compounds. The amino group contributes to its basicity, while the bromine atoms enhance its reactivity, making it useful in various chemical reactions, including electrophilic substitution. Additionally, the presence of the hydroxyl group (from the phenol) imparts some degree of solubility in polar solvents. Safety considerations should be taken into account when handling this compound, as brominated compounds can be hazardous. Overall, 2-amino-4,6-dibromophenol is a versatile chemical with significant relevance in organic synthesis and materials science.
Formula:C6H5Br2NO
InChI:InChI=1/C6H5Br2NO/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H,9H2
InChI key:UFWSOGOVXJBJDP-UHFFFAOYSA-N
SMILES:c1c(cc(c(c1Br)O)N)Br
Found 4 products.