CymitQuimica logo

CAS 1054451-31-8

:

Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis- 4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid

Description:
Boronic acids are a class of organic compounds characterized by the presence of a boron atom bonded to a hydroxyl group and an organic substituent. The specific compound you mentioned, with the CAS number 1054451-31-8, features a complex structure that includes multiple phenyl groups and a boronic acid functional group. This compound is likely to exhibit properties typical of boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and materials science. The presence of multiple phenyl rings may enhance its stability and solubility in organic solvents, while also potentially imparting unique electronic properties. Additionally, boronic acids are known for their role in Suzuki coupling reactions, which are important in the formation of carbon-carbon bonds in organic chemistry. Overall, this compound's intricate structure suggests it may have specialized applications in fields such as medicinal chemistry or polymer science, where its reactivity and stability can be advantageous.
Formula:C26H22B2O4
InChI:InChI=1S/C26H22B2O4/c29-27(30)23-15-11-21(12-16-23)25(19-7-3-1-4-8-19)26(20-9-5-2-6-10-20)22-13-17-24(18-14-22)28(31)32/h1-18,29-32H/b26-25+
InChI key:CFKHFTZRFSABDV-OCEACIFDSA-N
SMILES:B(C1=CC=C(C=C1)/C(=C(\C2=CC=CC=C2)/C3=CC=C(C=C3)B(O)O)/C4=CC=CC=C4)(O)O
Synonyms:
  • [(1,2-Diphenylethene-1,2-diyl)bis(4,1-phenylene)]diboronic acid
  • Boronic acid, B,B'-[(1,2-diphenyl-1,2-ethenediyl)di-4,1-phenylene]bis-
  • 4,4'-(1,2-diphenylethene-1,2-diyl)bis(1,4-phenylene)diboronic acid
  • 4,4'-(1,2-Diphenyl-1,2-ethenylene)diphenylboronic acid
  • 4,4'-(1,2-Diphenylethene-1,2-diyl)bis(1,4-phenylene)diboronic acid
  • (1,2-diphenylethene-1,2-diyl)bis(4,4'-phenylene)-1,1'-diboronic acid
  • TPE-BA
  • 4,4'-(1,2-diphenylethene-1,2-diyl)bis(4,1-phenylene)diboronic acid
Found 3 products.