CymitQuimica logo

CAS 10547-61-2

:

(3-CHLORO-4-METHOXYPHENYL)(PHENYL)METHANONE

Description:
(3-Chloro-4-methoxyphenyl)(phenyl)methanone, with the CAS number 10547-61-2, is an organic compound characterized by its structure, which features a phenyl group attached to a carbonyl group (ketone) and a substituted aromatic ring. The presence of a chloro group and a methoxy group on the aromatic ring contributes to its chemical reactivity and physical properties. This compound typically exhibits moderate solubility in organic solvents due to its aromatic nature, while its polar functional groups can influence its interactions with other molecules. It may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, making it of interest in synthetic organic chemistry. Additionally, the presence of the methoxy group can enhance its electron-donating properties, potentially affecting its reactivity and stability. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards.
Formula:C14H11ClO2
InChI:InChI=1S/C14H11ClO2/c1-17-13-8-7-11(9-12(13)15)14(16)10-5-3-2-4-6-10/h2-9H,1H3
InChI key:IGNLOYXQTDSIAQ-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C=C1)C(=O)C2=CC=CC=C2)Cl
Synonyms:
  • (3-CHLORO-4-METHOXYPHENYL)(PHENYL)METHANONE
  • Methanone, (3-chloro-4-methoxyphenyl)phenyl-
Found 2 products.