CAS 10552-74-6
:Nitrothal-isopropyl
Description:
Nitrothal-isopropyl, identified by its CAS number 10552-74-6, is a chemical compound that belongs to the class of nitro compounds. It is characterized by the presence of a nitro group (-NO2) attached to an isopropyl group, which contributes to its reactivity and potential applications in various chemical processes. Nitrothal-isopropyl is typically a colorless to pale yellow liquid, exhibiting moderate volatility and solubility in organic solvents. Its chemical structure allows for participation in electrophilic aromatic substitution reactions, making it useful in synthetic organic chemistry. Additionally, due to the presence of the nitro group, it may exhibit explosive properties under certain conditions, necessitating careful handling and storage. The compound's applications can range from use in pharmaceuticals to its role as an intermediate in the synthesis of more complex organic molecules. As with all nitro compounds, safety precautions are essential when working with Nitrothal-isopropyl to mitigate risks associated with its reactivity and potential toxicity.
Formula:C14H17NO6
InChI:InChI=1S/C14H17NO6/c1-8(2)20-13(16)10-5-11(14(17)21-9(3)4)7-12(6-10)15(18)19/h5-9H,1-4H3
InChI key:InChIKey=VJAWBEFMCIINFU-UHFFFAOYSA-N
SMILES:C(OC(C)C)(=O)C1=CC(C(OC(C)C)=O)=CC(N(=O)=O)=C1
Synonyms:- 1,3-Benzenedicarboxylic acid, 5-nitro-, 1,3-bis(1-methylethyl) ester
- 1,3-Benzenedicarboxylic acid, 5-nitro-, bis(1-methylethyl) ester
- Bis(1-methylethyl) 5-nitro-1,3-benzenedicarboxylate
- Dipropan-2-Yl 5-Nitrobenzene-1,3-Dicarboxylate
- Isophthalic acid, 5-nitro-, diisopropyl ester
- Nitrothal-isopropyl
- Nitrothal-isopropyl [BSI:ISO]
- Nitrothale-isopropyl
- Nitrothale-isopropyl [French]
- Pallitop
- Diisopropyl 5-nitroisophthalate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Nitrothal-isopropyl
CAS:Controlled ProductFormula:C14H17NO6Color and Shape:NeatMolecular weight:295.29Nitrothal-isopropyl
CAS:Controlled ProductFormula:C14H17NO6Color and Shape:NeatMolecular weight:295.29Nitrothal-isopropyl-d14
CAS:Controlled ProductApplications Isotope labelled Nitrothal-isopropyl is a pesticide.
References Li, K. et al.: Fenxi Shi., 34, 236 (2015);Formula:C14D14H3NO6Color and Shape:NeatMolecular weight:309.374

