CymitQuimica logo

CAS 10553-09-0

:

5-Methyl-7-nitro-1H-indole

Description:
5-Methyl-7-nitro-1H-indole is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a methyl group at the 5-position and a nitro group at the 7-position contributes to its unique chemical properties. This compound typically appears as a solid and is known for its potential applications in pharmaceuticals and organic synthesis. It exhibits moderate solubility in organic solvents, while its reactivity can be influenced by the electron-withdrawing nitro group, which can participate in various chemical reactions, such as electrophilic substitutions. The compound's molecular structure allows for potential interactions with biological systems, making it of interest in medicinal chemistry. Additionally, its stability under standard conditions is a notable characteristic, although it may undergo degradation under extreme conditions or in the presence of strong acids or bases. Overall, 5-Methyl-7-nitro-1H-indole is a significant compound in the realm of organic chemistry, with implications for further research and development.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-6-4-7-2-3-10-9(7)8(5-6)11(12)13/h2-5,10H,1H3
InChI key:InChIKey=GWNRCDPHHKVJTP-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C2C(=CC(C)=C1)C=CN2
Synonyms:
  • 5-Methyl-7-nitro-1H-indole
  • Indole, 5-methyl-7-nitro-
  • 1H-Indole, 5-methyl-7-nitro-
Found 3 products.