CymitQuimica logo

CAS 105538-02-1

:

3-AMINO-6-(THIOPHEN-3-YL)PYRIDAZINE

Description:
3-Amino-6-(thiophen-3-yl)pyridazine is a heterocyclic organic compound characterized by the presence of both a pyridazine ring and a thiophene moiety. The pyridazine ring is a six-membered aromatic structure containing two nitrogen atoms at positions 1 and 2, while the thiophene component contributes a five-membered aromatic ring containing sulfur. This compound typically exhibits properties such as moderate solubility in polar solvents and potential reactivity due to the amino group, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The presence of the thiophene ring may impart additional electronic properties, making it of interest in organic electronics and medicinal chemistry. Compounds like 3-amino-6-(thiophen-3-yl)pyridazine are often studied for their biological activities, including potential antimicrobial or anticancer properties, due to the structural diversity and functional groups that can interact with biological targets. Overall, this compound represents a valuable scaffold in the development of new pharmaceuticals and materials.
Formula:C8H7N3S
InChI:InChI=1/C8H7N3S/c9-8-2-1-7(10-11-8)6-3-4-12-5-6/h1-5H,(H2,9,11)
SMILES:c1cc(=N)[nH]nc1c1ccsc1
Synonyms:
  • 3-Amino-6-thien-3-ylpyridazine
  • 6-(Thiophen-3-Yl)Pyridazin-3-Amine
Found 1 products.