CymitQuimica logo

CAS 105566-68-5

:

3,3,12,12-tetramethoxy-2,13-dioxa-3,12-disilatetradecane

Description:
3,3,12,12-tetramethoxy-2,13-dioxa-3,12-disilatetradecane is a siloxane compound characterized by its unique structure, which includes multiple methoxy groups and siloxane linkages. This compound features a long carbon chain, specifically a tetradecane backbone, which contributes to its hydrophobic properties. The presence of the two dioxane units introduces oxygen atoms into the structure, enhancing its polarity and potential solubility in polar solvents. The methoxy groups can influence the compound's reactivity and stability, making it useful in various applications, including as a precursor in organic synthesis or in materials science. Its siloxane components may impart flexibility and thermal stability, which are desirable traits in polymeric materials. Additionally, the compound's specific arrangement of functional groups can affect its interaction with other molecules, making it of interest in fields such as drug delivery or surface modification. Overall, 3,3,12,12-tetramethoxy-2,13-dioxa-3,12-disilatetradecane is a complex molecule with diverse potential applications due to its unique chemical characteristics.
Formula:C14H34O6Si2
InChI:InChI=1/C14H34O6Si2/c1-15-21(16-2,17-3)13-11-9-7-8-10-12-14-22(18-4,19-5)20-6/h7-14H2,1-6H3
InChI key:InChIKey=SHCGUUKICQTMGF-UHFFFAOYSA-N
SMILES:CO[Si](CCCCCCCC[Si](OC)(OC)OC)(OC)OC
Synonyms:
  • 1,8-Bis(trimethoxysilyl)octane
  • 2,13-Dioxa-3,12-Disilatetradecane, 3,3,12,12-Tetramethoxy-
  • Kbm 3086
  • M 3086
  • 3,3,12,12-Tetramethoxy-2,13-dioxa-3,12-disilatetradecane
Found 4 products.