CymitQuimica logo

CAS 105592-29-8

:

BENZYL 2,3-O-ISOPROPYLIDENE-L-GLYCERO-ALPHA-D-MANNOHEPTOFURANOSIDE

Description:
Benzyl 2,3-O-isopropylidene-L-glycero-alpha-D-mannoheptofuranoside is a glycoside compound characterized by its complex structure, which includes a benzyl group and a furanoside moiety derived from D-mannoheptose. This compound features an isopropylidene protecting group on the hydroxyl functionalities at the 2 and 3 positions, which enhances its stability and solubility in organic solvents. It is typically used in carbohydrate chemistry and biochemistry for the synthesis of more complex molecules, as well as in studies related to glycosylation reactions. The presence of the benzyl group can also influence its reactivity and interactions in various chemical environments. As a glycoside, it may exhibit biological activity, potentially interacting with enzymes or receptors in biological systems. Its specific properties, such as solubility, melting point, and reactivity, would depend on the conditions under which it is studied or utilized. Overall, this compound serves as a valuable intermediate in synthetic organic chemistry and carbohydrate research.
Formula:C17H24O7
InChI:InChI=1S/C17H24O7/c1-17(2)23-14-13(12(20)11(19)8-18)22-16(15(14)24-17)21-9-10-6-4-3-5-7-10/h3-7,11-16,18-20H,8-9H2,1-2H3/t11-,12+,13+,14-,15-,16-/m0/s1
InChI key:QYCQBMVUWJKAQL-XFHWEBQZSA-N
SMILES:CC1(O[C@@H]2[C@H](O1)[C@H](O[C@@H]2[C@@H]([C@H](CO)O)O)OCC3=CC=CC=C3)C
Found 2 products.