CymitQuimica logo

CAS 1056265-33-8

:

1H-Indazole, 3-Methyl-4-(phenylMethoxy)-

Description:
1H-Indazole, 3-Methyl-4-(phenylmethoxy)- is an organic compound characterized by its indazole core, which consists of a five-membered ring containing two nitrogen atoms. The presence of a methyl group at the 3-position and a phenylmethoxy group at the 4-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the indazole moiety, which is known for various biological activities. The compound may also display interesting electronic properties due to the conjugation between the aromatic phenyl group and the indazole ring. As with many organic compounds, its reactivity can be influenced by the functional groups present, making it a candidate for further chemical modifications or derivatizations in synthetic chemistry. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper laboratory practices.
Formula:C15H14N2O
InChI:InChI=1S/C15H14N2O/c1-11-15-13(17-16-11)8-5-9-14(15)18-10-12-6-3-2-4-7-12/h2-9H,10H2,1H3,(H,16,17)
InChI key:KZKVKULJRGKFCD-UHFFFAOYSA-N
SMILES:CC1=C2C(=NN1)C=CC=C2OCC3=CC=CC=C3
Found 3 products.