CymitQuimica logo

CAS 1056619-14-7

:

2-(tetrahydrofuran-3-yl)acetic acid

Description:
2-(Tetrahydrofuran-3-yl)acetic acid is an organic compound characterized by the presence of a tetrahydrofuran ring and a carboxylic acid functional group. The tetrahydrofuran moiety contributes to its cyclic structure, which can influence its reactivity and solubility properties. This compound typically exhibits moderate polarity due to the presence of the carboxylic acid group, making it soluble in polar solvents like water and alcohols. Its structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, where the tetrahydrofuran ring can serve as a versatile building block. Additionally, the presence of the carboxylic acid group may impart acidic properties, allowing for participation in various chemical reactions, such as esterification or amidation. The compound's specific physical properties, such as boiling point, melting point, and density, would need to be determined experimentally or sourced from reliable databases, as they can vary based on purity and environmental conditions. Overall, 2-(tetrahydrofuran-3-yl)acetic acid is a compound of interest in both academic and industrial chemistry contexts.
Formula:C9H9N3O3
InChI:InChI=1S/C9H9N3O3/c13-4-3-11-9-2-1-8(12(14)15)5-7(9)6-10-11/h1-2,5-6,13H,3-4H2
InChI key:ARJLAPREGBZGMU-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1[N+](=O)[O-])C=NN2CCO
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.