CAS 10567-22-3

3-O-Octadecyl-sn-glycerol

Description:

3-O-Octadecyl-sn-glycerol, also known as octadecyl glycerol, is a glycerol derivative characterized by the presence of an octadecyl (C18) alkyl chain attached to the glycerol backbone at the 3-position. This compound is typically a colorless to pale yellow viscous liquid or solid, depending on temperature and purity. It is hydrophobic due to the long alkyl chain, which imparts surfactant properties, making it useful in various applications, including emulsification and stabilization in cosmetic and pharmaceutical formulations. The presence of the glycerol moiety allows for potential interactions with polar solvents, although the overall hydrophobic nature predominates. Its molecular structure contributes to its role as a surfactant, enhancing the solubility of hydrophobic compounds in aqueous environments. Additionally, 3-O-Octadecyl-sn-glycerol may exhibit biocompatibility, making it suitable for use in drug delivery systems. As with many chemical substances, safety data should be consulted to understand its handling and potential hazards.

Formula: C₂₁H₄₄O₃

InChI: InChI=1S/C21H44O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-24-20-21(23)19-22/h21-23H,2-20H2,1H3/t21-/m1/s1

InChI key: OGBUMNBNEWYMNJ-OAQYLSRUSA-N

SMILES: CCCCCCCCCCCCCCCCCCOC[C@@H](CO)O

(R)-3-(Octadecyloxy)propane-1,2-diol

CAS: 10567-22-3

(R)-3-(Octadecyloxy)propane-1,2-diol

Formula: C₂₁H₄₄O₃

Purity: 95%

Molecular weight: 344.57

Ref: IN-DG01569474

3-O-Octadecyl sn-Glycerol

Controlled Product

CAS: 10567-22-3

Applications 3-O-Octadecyl sn-Glycerol is used to link zidovudine and foscarnet to prepare an antiviral duplex drug. It is also used to prepare foscarnet conjugates with antiviral activities in human cytomegalovirus-infected cells.
References Schott, H., et al.: Bioorg. Med. Chem., 17, 303 (2009); Kini, G., et al.: Antiviral Res., 36, 115 (1997)

Formula: C₂₁H₄₄O₃

Color and Shape: Neat

Molecular weight: 344.572

Ref: TR-O268040