CymitQuimica logo

CAS 105679-33-2

:

2H-1,4-Benzoxazine, 7-bromo-6-chloro-3,4-dihydro-

Description:
2H-1,4-Benzoxazine, 7-bromo-6-chloro-3,4-dihydro- is a heterocyclic organic compound characterized by its benzoxazine structure, which consists of a fused benzene and oxazine ring. This compound features bromine and chlorine substituents, which can influence its reactivity and physical properties. Typically, benzoxazines exhibit interesting thermal and chemical stability, making them valuable in various applications, including polymer science and materials engineering. The presence of halogen atoms, such as bromine and chlorine, can enhance the compound's reactivity, potentially allowing for further functionalization or use in synthesis. Additionally, compounds of this class may exhibit biological activity, although specific biological properties would require further investigation. The molecular structure contributes to its potential applications in fields such as pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Overall, 2H-1,4-Benzoxazine, 7-bromo-6-chloro-3,4-dihydro- represents a versatile compound with unique characteristics stemming from its structural features and substituents.
Formula:C8H7BrClNO
InChI:InChI=1S/C8H7BrClNO/c9-5-3-8-7(4-6(5)10)11-1-2-12-8/h3-4,11H,1-2H2
InChI key:BAUAOJVZMYGURE-UHFFFAOYSA-N
SMILES:C1COC2=CC(=C(C=C2N1)Cl)Br
Found 5 products.