CymitQuimica logo

CAS 105684-82-0

:

Benzoxazole, 4-(1-piperazinyl)-

Description:
Benzoxazole, 4-(1-piperazinyl)- is a heterocyclic organic compound characterized by the presence of a benzoxazole ring fused with a piperazine moiety. This compound typically exhibits a white to off-white crystalline appearance and is soluble in polar organic solvents. The benzoxazole structure contributes to its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The piperazine group enhances its pharmacological properties, often improving binding affinity to biological targets. This compound may exhibit various biological activities, including antimicrobial, antifungal, or anticancer properties, making it of interest in drug discovery. Additionally, its molecular structure allows for potential interactions with neurotransmitter systems, which could be relevant in the development of central nervous system agents. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, Benzoxazole, 4-(1-piperazinyl)- represents a significant compound in the field of organic and medicinal chemistry.
Formula:C11H13N3O
InChI:InChI=1S/C11H13N3O/c1-2-9(14-6-4-12-5-7-14)11-10(3-1)15-8-13-11/h1-3,8,12H,4-7H2
InChI key:ABQLIOHPHGHDFE-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C2=C3C(=CC=C2)OC=N3
Synonyms:
  • Benzoxazole, 4-(1-piperazinyl)-
  • 4-(Piperazin-1-yl)-1,3-benzoxazole
  • 4-(Piperazin-1-yl)benzo[d]oxazole
Found 2 products.