CymitQuimica logo

CAS 105685-34-5

:

Piperazine, 1-(4-benzofuranyl)-

Description:
Piperazine, 1-(4-benzofuranyl)- is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms at opposite positions. This compound features a benzofuran moiety, which is a fused ring system consisting of a benzene ring and a furan ring, attached to one of the nitrogen atoms of the piperazine. The presence of the benzofuran group contributes to its potential biological activity and pharmacological properties. Piperazine derivatives are often studied for their effects on the central nervous system and may exhibit various therapeutic applications, including anxiolytic and antidepressant effects. The compound is typically a white to off-white solid and is soluble in organic solvents. Its molecular structure allows for interactions with various biological targets, making it of interest in medicinal chemistry. As with many piperazine derivatives, the specific characteristics, such as solubility and reactivity, can vary based on the substituents and the overall molecular configuration.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-2-11(14-7-5-13-6-8-14)10-4-9-15-12(10)3-1/h1-4,9,13H,5-8H2
InChI key:IAMHGDMQKHPUMM-UHFFFAOYSA-N
SMILES:C1CN(CCN1)C2=C3C=COC3=CC=C2
Synonyms:
  • Brexpiprazole Impurity 74
  • Epipiprazole Impurity 20
  • Piperazine, 1-(4-benzofuranyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.