CymitQuimica logo

CAS 1056901-62-2

:

AT13148

Description:
AT13148, with the CAS number 1056901-62-2, is a chemical compound that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. While specific characteristics such as molecular weight, structure, and solubility may vary, compounds like AT13148 are often characterized by their ability to interact with biological targets, potentially influencing cellular pathways. This compound may exhibit properties such as selectivity for certain enzymes or receptors, which is crucial for its efficacy in drug development. Additionally, its stability, bioavailability, and pharmacokinetic profile are important factors that determine its suitability for clinical use. As research progresses, more detailed information regarding its mechanism of action, safety profile, and therapeutic potential will likely emerge, contributing to a better understanding of its role in pharmacology. For precise data, including experimental results and specific applications, consulting scientific literature or databases is recommended.
Formula:C17H16ClN3O
InChI:InChI=1S/C17H16ClN3O/c18-16-7-5-15(6-8-16)17(22,11-19)14-3-1-12(2-4-14)13-9-20-21-10-13/h1-10,22H,11,19H2,(H,20,21)/t17-/m0/s1
InChI key:IIRWNGPLJQXWFJ-KRWDZBQOSA-N
SMILES:C1=CC(=CC=C1C2=CNN=C2)[C@@](CN)(C3=CC=C(C=C3)Cl)O
Found 6 products.