CymitQuimica logo

CAS 105729-06-4

:

2-methoxy-1-(2-pyridyl)ethanone

Description:
2-Methoxy-1-(2-pyridyl)ethanone, with the CAS number 105729-06-4, is an organic compound characterized by its methoxy and pyridyl functional groups. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the pyridine ring imparts unique electronic properties, making it a candidate for various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Typically, compounds like this exhibit moderate polarity due to the methoxy group, which can influence solubility in organic solvents. Additionally, the structure suggests potential biological activity, as many pyridine derivatives are known for their pharmacological properties. The compound may be used in the synthesis of more complex molecules or as an intermediate in the production of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H9NO2
InChI:InChI=1/C8H9NO2/c1-11-6-8(10)7-4-2-3-5-9-7/h2-5H,6H2,1H3
SMILES:COCC(=O)c1ccccn1
Found 1 products.