CymitQuimica logo

CAS 105772-14-3

:

Methyl 3,6-dihydro-2H-pyran-4-carboxylate

Description:
Methyl 3,6-dihydro-2H-pyran-4-carboxylate is an organic compound characterized by its pyran ring structure, which features a five-membered ring containing one oxygen atom. This compound is classified as an ester due to the presence of a carboxylate group, specifically a methyl ester, which contributes to its reactivity and solubility properties. It typically appears as a colorless to pale yellow liquid with a pleasant odor. The compound is known for its potential applications in organic synthesis, particularly in the preparation of various pharmaceuticals and agrochemicals. Its reactivity can be attributed to the presence of both the ester and the cyclic ether functionalities, allowing for various chemical transformations. Additionally, it may exhibit moderate polarity, making it soluble in organic solvents while having limited solubility in water. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H10O3
InChI:InChI=1S/C7H10O3/c1-9-7(8)6-2-4-10-5-3-6/h2H,3-5H2,1H3
InChI key:InChIKey=CNYKIGVYXIGUHQ-UHFFFAOYSA-N
SMILES:C(OC)(=O)C=1CCOCC1
Synonyms:
  • 2H-Pyran-4-Carboxylic Acid, 3,6-Dihydro-, Methyl Ester
  • methyl 3,6-dihydro-2H-pyran-4-carboxylate
Found 5 products.