CAS 1058-61-3
:Stigmast-4-en-3-one
Description:
Stigmast-4-en-3-one, with the CAS number 1058-61-3, is a steroidal compound characterized by its unsaturated ketone structure. It features a stigmastane backbone, which is a tetracyclic structure typical of many sterols and steroids. The compound has a double bond at the 4-position and a ketone functional group at the 3-position, contributing to its reactivity and biological activity. Stigmast-4-en-3-one is often found in various plant sources and is of interest in the study of phytosterols, which are known for their potential health benefits, including cholesterol-lowering properties. The compound is typically solid at room temperature and is soluble in organic solvents. Its presence in natural products makes it relevant in fields such as biochemistry, pharmacology, and nutrition. Additionally, it may serve as a precursor for the synthesis of other steroidal compounds, highlighting its significance in organic chemistry and medicinal applications.
Formula:C29H48O
InChI:InChI=1S/C29H48O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h18-21,24-27H,7-17H2,1-6H3/t20-,21-,24+,25-,26+,27+,28+,29-/m1/s1
InChI key:InChIKey=RUVUHIUYGJBLGI-XJZKHKOHSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@]([C@]4(C)C(CC3)=CC(=O)CC4)(CC1)[H])[H])(CC[C@@]2([C@@H](CC[C@H](C(C)C)CC)C)[H])[H]
Synonyms:- (17Xi)-Stigmast-4-En-3-One
- (24R)-24-Ethylcholest-4-en-3-one
- (24R)-Stigmast-4-en-3-one
- 4-En-3-stigmastone
- BETA-Sitostenone
- NSC 49082
- Sitostenone
- Sitostenone, BETA-
- Stigmast-4-En-3-One
- Δ<sup>4</sup>-Sitosterol-3-one
- β-Rosasterol oxide
- β-Sitost-4-en-3-one
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Ref: IN-DA007WLE
1gTo inquire50mgTo inquire100mgTo inquire250mgTo inquire1mg145.00€5mg189.00€25mg304.00€10mg498.00€Sitostenone
CAS:Sitostenone, an antioxidant, treats androgen-related diseases, such as benign prostatic hyperplasia.Formula:C29H48OPurity:98% - 98%Color and Shape:SolidMolecular weight:412.69Sitostenone
CAS:Controlled ProductSitostenone is a steroidal ketone, which is derived from plant sterols, primarily β-sitosterol, commonly found in various plant sources such as nuts, seeds, and vegetables. Its mode of action involves participation in metabolic pathways that influence the synthesis and regulation of key biomolecules, potentially altering cellular processes at a biochemical level. Sitostenone, like its sterol precursors, may play a role in cell membrane stability and function due to its structural resemblance to cholesterol.Formula:C29H48OPurity:Min. 95%Color and Shape:PowderMolecular weight:412.7 g/mol







