CAS 105802-84-4

pro-leu-ser-arg-thr-leu-ser-val-ala-*ala-lys-lys

Description:

The chemical substance with the name "pro-leu-ser-arg-thr-leu-ser-val-ala-ala-lys-lys" and CAS number 105802-84-4 is a synthetic peptide composed of a specific sequence of amino acids. This peptide features a combination of proline, leucine, serine, arginine, threonine, valine, alanine, and lysine, which are essential building blocks of proteins. Peptides like this one can exhibit various biological activities, including roles in signaling, regulation of physiological processes, and potential therapeutic applications. The sequence and composition of amino acids influence the peptide's structure, stability, and interactions with biological targets. Such peptides may be studied for their potential in drug development, particularly in areas like immunology, oncology, and metabolic disorders. Additionally, the presence of lysine residues may suggest potential for post-translational modifications, such as acetylation or methylation, which can further affect the peptide's function and activity. Overall, the characteristics of this peptide make it a subject of interest in biochemical and pharmaceutical research.

Formula: C₅₆H₁₀₃N₁₇O₁₆

InChI: InChI=1S/C56H103N17O16/c1-28(2)24-38(68-46(79)34-18-14-22-61-34)49(82)70-40(26-74)51(84)66-36(19-15-23-62-56(59)60)48(81)73-43(33(9)76)54(87)69-39(25-29(3)4)50(83)71-41(27-75)52(85)72-42(30(5)6)53(86)64-31(7)44(77)63-32(8)45(78)65-35(16-10-12-20-57)47(80)67-37(55(88)89)17-11-13-21-58/h28-43,61,74-76H,10-27,57-58H2,1-9H3,(H,63,77)(H,64,86)(H,65,78)(H,66,84)(H,67,80)(H,68,79)(H,69,87)(H,70,82)(H,71,83)(H,72,85)(H,73,81)(H,88,89)(H4,59,60,62)

InChI key: AATOURFPKKEISN-UHFFFAOYSA-N

SMILES: CC(C)CC(C(=O)NC(CO)C(=O)NC(CCCN=C(N)N)C(=O)NC(C(C)O)C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(C(C)C)C(=O)NC(C)C(=O)NC(C)C(=O)NC(CCCCN)C(=O)NC(CCCCN)C(=O)O)NC(=O)C1CCCN1

Synonyms:

• H-Pro-Leu-Ser-Arg-Thr-Leu-Ser-Val-Ala-Ala-Lys-Lys-OH

[Ala9,10, Lys11,12] Glycogen Synthase (1-12)

CAS: 105802-84-4

[Ala9,10, Lys11,12] Glycogen Synthase (1-12): PKC's selective phosphorylation substrate, used to assess PKC activity. [1]

Formula: C₅₆H₁₀₃N₁₇O₁₆

Color and Shape: Solid

Molecular weight: 1270.52

Ref: TM-T76380

H-Pro-Leu-Ser-Arg-Thr-Leu-Ser-Val-Ala-Ala-Lys-Lys-OH

CAS: 105802-84-4

Acetylcholine (ACh) is a neurotransmitter found in the brain and other parts of the nervous system. It is synthesized from choline and acetyl-CoA by the enzyme choline acetyltransferase. ACh is hydrolyzed into choline and acetyl-CoA by acetylcholinesterase, which is located at synapses. This reaction produces an inactive metabolite, acetic acid, as a byproduct. Acetylcholine plays a role in many biological processes such as muscle contraction, memory formation, and learning.

Formula: C₅₆H₁₀₃N₁₇O₁₆

Purity: Min. 95%

Molecular weight: 1,270.52 g/mol

Ref: 3D-FP110423