CymitQuimica logo

CAS 1058062-64-8

:

2-Amino-5-(trifluoromethyl)phenylboronic acid, pinacol ester

Description:
2-Amino-5-(trifluoromethyl)phenylboronic acid, pinacol ester, is an organoboron compound characterized by the presence of a boronic acid functional group and a trifluoromethyl substituent on a phenyl ring. This compound typically exhibits a white to off-white solid appearance and is soluble in organic solvents. The boronic acid moiety allows for participation in various chemical reactions, particularly in Suzuki coupling reactions, making it valuable in organic synthesis and medicinal chemistry. The trifluoromethyl group enhances the compound's lipophilicity and can influence its biological activity. Additionally, the presence of the amino group can facilitate hydrogen bonding and increase the compound's reactivity. This compound is often used in the development of pharmaceuticals and agrochemicals due to its ability to form stable complexes with various substrates. Safety data should be consulted for handling, as organoboron compounds can have specific hazards associated with their use. Overall, 2-Amino-5-(trifluoromethyl)phenylboronic acid, pinacol ester, is a versatile building block in synthetic chemistry.
Formula:C13H17BF3NO2
InChI:InChI=1S/C13H17BF3NO2/c1-11(2)12(3,4)20-14(19-11)9-7-8(13(15,16)17)5-6-10(9)18/h5-7H,18H2,1-4H3
InChI key:GFSAGCJSHFVPJZ-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(F)(F)F)N
Found 4 products.